C11H7BrN6O3S — CID 9420484
N-(1,3-benzothiazol-2-yl)-2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)acetamide (PubChem CID 9420484) has the molecular formula C11H7BrN6O3S and a molecular weight of 383.19 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 9420484 |
| Molecular Formula | C11H7BrN6O3S |
| Molecular Weight | 383.19 g/mol |
| Exact Mass | 381.95 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)acetamide |
| SMILES | O=C(Cn1nc([N+](=O)[O-])nc1Br)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C11H7BrN6O3S/c12-9-15-10(18(20)21)16-17(9)5-8(19)14-11-13-6-3-1-2-4-7(6)22-11/h1-4H,5H2,(H,13,14,19) |
| InChIKey | NGIZHPHSBYQDSZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|