C12H12BrN5O3 — CID 577482
2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-N-(3,4-dimethylphenyl)acetamide (PubChem CID 577482) has the molecular formula C12H12BrN5O3 and a molecular weight of 354.16 g/mol. Its IUPAC name is 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-N-(3,4-dimethylphenyl)acetamide.
| Compound Name | 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-N-(3,4-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 577482 |
| Molecular Formula | C12H12BrN5O3 |
| Molecular Weight | 354.16 g/mol |
| Exact Mass | 353.01 |
| IUPAC Name | 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-N-(3,4-dimethylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2nc([N+](=O)[O-])nc2Br)cc1C |
| InChI | InChI=1S/C12H12BrN5O3/c1-7-3-4-9(5-8(7)2)14-10(19)6-17-11(13)15-12(16-17)18(20)21/h3-5H,6H2,1-2H3,(H,14,19) |
| InChIKey | WKEWQZLRBNJKOC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.16 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|