C10H8BrN5O3 — CID 555265
2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-N-phenylacetamide (PubChem CID 555265) has the molecular formula C10H8BrN5O3 and a molecular weight of 326.11 g/mol. Its IUPAC name is 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-N-phenylacetamide.
| Compound Name | 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-N-phenylacetamide |
|---|---|
| PubChem CID | 555265 |
| Molecular Formula | C10H8BrN5O3 |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | 2-(5-bromo-3-nitro-1,2,4-triazol-1-yl)-N-phenylacetamide |
| SMILES | O=C(Cn1nc([N+](=O)[O-])nc1Br)Nc1ccccc1 |
| InChI | InChI=1S/C10H8BrN5O3/c11-9-13-10(16(18)19)14-15(9)6-8(17)12-7-4-2-1-3-5-7/h1-5H,6H2,(H,12,17) |
| InChIKey | OYTWATIKKRDBPD-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|