C11H10N4O3 — CID 9420213
2-(5-methyl-3-nitro-1,2,4-triazol-1-yl)-1-phenylethanone (PubChem CID 9420213) has the molecular formula C11H10N4O3 and a molecular weight of 246.23 g/mol. Its IUPAC name is 2-(5-methyl-3-nitro-1,2,4-triazol-1-yl)-1-phenylethanone.
| Compound Name | 2-(5-methyl-3-nitro-1,2,4-triazol-1-yl)-1-phenylethanone |
|---|---|
| PubChem CID | 9420213 |
| Molecular Formula | C11H10N4O3 |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-(5-methyl-3-nitro-1,2,4-triazol-1-yl)-1-phenylethanone |
| SMILES | Cc1nc([N+](=O)[O-])nn1CC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H10N4O3/c1-8-12-11(15(17)18)13-14(8)7-10(16)9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
| InChIKey | LKTRKHKTGLWBMA-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 90.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|