C9H9N5O2 — CID 563426
2-benzyl-5-nitro-1,2,4-triazol-3-amine (PubChem CID 563426) has the molecular formula C9H9N5O2 and a molecular weight of 219.20 g/mol. Its IUPAC name is 2-benzyl-5-nitro-1,2,4-triazol-3-amine.
| Compound Name | 2-benzyl-5-nitro-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 563426 |
| Molecular Formula | C9H9N5O2 |
| Molecular Weight | 219.20 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-benzyl-5-nitro-1,2,4-triazol-3-amine |
| SMILES | Nc1nc([N+](=O)[O-])nn1Cc1ccccc1 |
| InChI | InChI=1S/C9H9N5O2/c10-8-11-9(14(15)16)12-13(8)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,11,12) |
| InChIKey | LHFMEENHEQYGRR-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.20 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|