C11H12N6O2 — CID 11322916
N-[(3-amino-2-benzyl-5-oxo-1,2,4-triazin-6-yl)amino]formamide (PubChem CID 11322916) has the molecular formula C11H12N6O2 and a molecular weight of 260.26 g/mol. Its IUPAC name is N-[(3-amino-2-benzyl-5-oxo-1,2,4-triazin-6-yl)amino]formamide.
| Compound Name | N-[(3-amino-2-benzyl-5-oxo-1,2,4-triazin-6-yl)amino]formamide |
|---|---|
| PubChem CID | 11322916 |
| Molecular Formula | C11H12N6O2 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.10 |
| IUPAC Name | N-[(3-amino-2-benzyl-5-oxo-1,2,4-triazin-6-yl)amino]formamide |
| SMILES | Nc1nc(=O)c(NNC=O)nn1Cc1ccccc1 |
| InChI | InChI=1S/C11H12N6O2/c12-11-14-10(19)9(15-13-7-18)16-17(11)6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H,13,18)(H,15,16)(H2,12,14,19) |
| InChIKey | ZMSDJJDGDCFDMK-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|