C14H17N5O — CID 91699873
(Z)-4-[(5-amino-1-benzyl-1,2,4-triazol-3-yl)amino]pent-3-en-2-one (PubChem CID 91699873) has the molecular formula C14H17N5O and a molecular weight of 271.32 g/mol. Its IUPAC name is (Z)-4-[(5-amino-1-benzyl-1,2,4-triazol-3-yl)amino]pent-3-en-2-one.
| Compound Name | (Z)-4-[(5-amino-1-benzyl-1,2,4-triazol-3-yl)amino]pent-3-en-2-one |
|---|---|
| PubChem CID | 91699873 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | (Z)-4-[(5-amino-1-benzyl-1,2,4-triazol-3-yl)amino]pent-3-en-2-one |
| SMILES | CC(=O)/C=C(/C)Nc1nc(N)n(Cc2ccccc2)n1 |
| InChI | InChI=1S/C14H17N5O/c1-10(8-11(2)20)16-14-17-13(15)19(18-14)9-12-6-4-3-5-7-12/h3-8H,9H2,1-2H3,(H3,15,16,17,18)/b10-8- |
| InChIKey | YLMMJNSVFQSLJI-NTMALXAHSA-N |
| XLogP | 1.81 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|