C20H27N5O2 — CID 56607109
N-[1-(3-amino-2-benzyl-5-oxo-1,2,4-triazin-6-yl)ethyl]-2-cyclohexylacetamide (PubChem CID 56607109) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is N-[1-(3-amino-2-benzyl-5-oxo-1,2,4-triazin-6-yl)ethyl]-2-cyclohexylacetamide.
| Compound Name | N-[1-(3-amino-2-benzyl-5-oxo-1,2,4-triazin-6-yl)ethyl]-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 56607109 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | N-[1-(3-amino-2-benzyl-5-oxo-1,2,4-triazin-6-yl)ethyl]-2-cyclohexylacetamide |
| SMILES | CC(NC(=O)CC1CCCCC1)c1nn(Cc2ccccc2)c(N)nc1=O |
| InChI | InChI=1S/C20H27N5O2/c1-14(22-17(26)12-15-8-4-2-5-9-15)18-19(27)23-20(21)25(24-18)13-16-10-6-3-7-11-16/h3,6-7,10-11,14-15H,2,4-5,8-9,12-13H2,1H3,(H,22,26)(H2,21,23,27) |
| InChIKey | GXESFRURCHJCJF-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |