C18H23N3O3 — CID 140549487
N-(3-benzyl-2,5-dioxoimidazolidin-1-yl)-2-cyclohexylacetamide (PubChem CID 140549487) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-(3-benzyl-2,5-dioxoimidazolidin-1-yl)-2-cyclohexylacetamide.
| Compound Name | N-(3-benzyl-2,5-dioxoimidazolidin-1-yl)-2-cyclohexylacetamide |
|---|---|
| PubChem CID | 140549487 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-(3-benzyl-2,5-dioxoimidazolidin-1-yl)-2-cyclohexylacetamide |
| SMILES | O=C(CC1CCCCC1)NN1C(=O)CN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C18H23N3O3/c22-16(11-14-7-3-1-4-8-14)19-21-17(23)13-20(18(21)24)12-15-9-5-2-6-10-15/h2,5-6,9-10,14H,1,3-4,7-8,11-13H2,(H,19,22) |
| InChIKey | AEUZHTMSMAGFPX-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|