About 1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide
1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide (PubChem CID 68593758) has the molecular formula C18H25N3O3
and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide.
Molecular Properties
| Compound Name | 1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide |
| PubChem CID | 68593758 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide |
| SMILES | NC(=O)CC1CCCCC1.O=C1CN(Cc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C10H10N2O2.C8H15NO/c13-9-7-12(10(14)11-9)6-8-4-2-1-3-5-8;9-8(10)6-7-4-2-1-3-5-7/h1-5H,6-7H2,(H,11,13,14);7H,1-6H2,(H2,9,10) |
| InChIKey | HJPVJSBPWUCASI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide?
The IUPAC name of 1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide (CID 68593758) is 1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide.
What is the SMILES notation for 1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide?
The canonical SMILES for 1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide is NC(=O)CC1CCCCC1.O=C1CN(Cc2ccccc2)C(=O)N1.
What is the InChIKey of 1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide?
The InChIKey is HJPVJSBPWUCASI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2.C8H15NO/c13-9-7-12(10(14)11-9)6-8-4-2-1-3-5-8;9-8(10)6-7-4-2-1-3-5-7/h1-5H,6-7H2,(H,11,13,14);7H,1-6H2,(H2,9,10).
What are the key properties of 1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide?
1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide has a molecular weight of 331.42 g/mol, XLogP of 2.18, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide is sourced from PubChem (CID 68593758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).