C18H25N3O3 — CID 68593758
1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide (PubChem CID 68593758) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide.
| Compound Name | 1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide |
|---|---|
| PubChem CID | 68593758 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 1-benzylimidazolidine-2,4-dione;2-cyclohexylacetamide |
| SMILES | NC(=O)CC1CCCCC1.O=C1CN(Cc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C10H10N2O2.C8H15NO/c13-9-7-12(10(14)11-9)6-8-4-2-1-3-5-8;9-8(10)6-7-4-2-1-3-5-7/h1-5H,6-7H2,(H,11,13,14);7H,1-6H2,(H2,9,10) |
| InChIKey | HJPVJSBPWUCASI-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|