C13H18ClN3O2 — CID 110283164
2-(4-benzyl-3-oxopiperazin-2-yl)acetamide;hydrochloride (PubChem CID 110283164) has the molecular formula C13H18ClN3O2 and a molecular weight of 283.76 g/mol. Its IUPAC name is 2-(4-benzyl-3-oxopiperazin-2-yl)acetamide;hydrochloride.
| Compound Name | 2-(4-benzyl-3-oxopiperazin-2-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 110283164 |
| Molecular Formula | C13H18ClN3O2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 2-(4-benzyl-3-oxopiperazin-2-yl)acetamide;hydrochloride |
| SMILES | Cl.NC(=O)CC1NCCN(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C13H17N3O2.ClH/c14-12(17)8-11-13(18)16(7-6-15-11)9-10-4-2-1-3-5-10;/h1-5,11,15H,6-9H2,(H2,14,17);1H |
| InChIKey | NDJTXPKBQYRJHA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |