About 2-[4-[(3,5-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide;hydrochloride
2-[4-[(3,5-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide;hydrochloride (PubChem CID 110283945) has the molecular formula C13H16ClF2N3O2
and a molecular weight of 319.74 g/mol. Its IUPAC name is 2-[4-[(3,5-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide;hydrochloride.
Molecular Properties
| Compound Name | 2-[4-[(3,5-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide;hydrochloride |
| PubChem CID | 110283945 |
| Molecular Formula | C13H16ClF2N3O2 |
| Molecular Weight | 319.74 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-[4-[(3,5-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide;hydrochloride |
| SMILES | Cl.NC(=O)CC1NCCN(Cc2cc(F)cc(F)c2)C1=O |
| InChI | InChI=1S/C13H15F2N3O2.ClH/c14-9-3-8(4-10(15)5-9)7-18-2-1-17-11(13(18)20)6-12(16)19;/h3-5,11,17H,1-2,6-7H2,(H2,16,19);1H |
| InChIKey | VUDPPTUYLOZYMO-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.74 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-[(3,5-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(3,5-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide;hydrochloride?
The IUPAC name of 2-[4-[(3,5-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide;hydrochloride (CID 110283945) is 2-[4-[(3,5-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide;hydrochloride.
What is the SMILES notation for 2-[4-[(3,5-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide;hydrochloride?
The canonical SMILES for 2-[4-[(3,5-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide;hydrochloride is Cl.NC(=O)CC1NCCN(Cc2cc(F)cc(F)c2)C1=O.
What is the InChIKey of 2-[4-[(3,5-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide;hydrochloride?
The InChIKey is VUDPPTUYLOZYMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F2N3O2.ClH/c14-9-3-8(4-10(15)5-9)7-18-2-1-17-11(13(18)20)6-12(16)19;/h3-5,11,17H,1-2,6-7H2,(H2,16,19);1H.
What are the key properties of 2-[4-[(3,5-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide;hydrochloride?
2-[4-[(3,5-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide;hydrochloride has a molecular weight of 319.74 g/mol, XLogP of 0.56, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(3,5-difluorophenyl)methyl]-3-oxopiperazin-2-yl]acetamide;hydrochloride is sourced from PubChem (CID 110283945), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).