About 2-cyclodecylacetamide
2-cyclodecylacetamide (PubChem CID 150110792) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 2-cyclodecylacetamide.
Molecular Properties
| Compound Name | 2-cyclodecylacetamide |
| PubChem CID | 150110792 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 2-cyclodecylacetamide |
| SMILES | NC(=O)CC1CCCCCCCCC1 |
| InChI | InChI=1S/C12H23NO/c13-12(14)10-11-8-6-4-2-1-3-5-7-9-11/h11H,1-10H2,(H2,13,14) |
| InChIKey | DXFDQNUEKRIWGA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclodecylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclodecylacetamide?
The IUPAC name of 2-cyclodecylacetamide (CID 150110792) is 2-cyclodecylacetamide.
What is the SMILES notation for 2-cyclodecylacetamide?
The canonical SMILES for 2-cyclodecylacetamide is NC(=O)CC1CCCCCCCCC1.
What is the InChIKey of 2-cyclodecylacetamide?
The InChIKey is DXFDQNUEKRIWGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c13-12(14)10-11-8-6-4-2-1-3-5-7-9-11/h11H,1-10H2,(H2,13,14).
What are the key properties of 2-cyclodecylacetamide?
2-cyclodecylacetamide has a molecular weight of 197.32 g/mol, XLogP of 3.00, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclodecylacetamide is sourced from PubChem (CID 150110792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).