About 2-cyclohexylacetic acid;ethane;methanamine
2-cyclohexylacetic acid;ethane;methanamine (PubChem CID 176577797) has the molecular formula C11H25NO2
and a molecular weight of 203.33 g/mol. Its IUPAC name is 2-cyclohexylacetic acid;ethane;methanamine.
Molecular Properties
| Compound Name | 2-cyclohexylacetic acid;ethane;methanamine |
| PubChem CID | 176577797 |
| Molecular Formula | C11H25NO2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | 2-cyclohexylacetic acid;ethane;methanamine |
| SMILES | CC.CN.O=C(O)CC1CCCCC1 |
| InChI | InChI=1S/C8H14O2.C2H6.CH5N/c9-8(10)6-7-4-2-1-3-5-7;2*1-2/h7H,1-6H2,(H,9,10);1-2H3;2H2,1H3 |
| InChIKey | IGNPXFRJSWVDQH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexylacetic acid;ethane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylacetic acid;ethane;methanamine?
The IUPAC name of 2-cyclohexylacetic acid;ethane;methanamine (CID 176577797) is 2-cyclohexylacetic acid;ethane;methanamine.
What is the SMILES notation for 2-cyclohexylacetic acid;ethane;methanamine?
The canonical SMILES for 2-cyclohexylacetic acid;ethane;methanamine is CC.CN.O=C(O)CC1CCCCC1.
What is the InChIKey of 2-cyclohexylacetic acid;ethane;methanamine?
The InChIKey is IGNPXFRJSWVDQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.C2H6.CH5N/c9-8(10)6-7-4-2-1-3-5-7;2*1-2/h7H,1-6H2,(H,9,10);1-2H3;2H2,1H3.
What are the key properties of 2-cyclohexylacetic acid;ethane;methanamine?
2-cyclohexylacetic acid;ethane;methanamine has a molecular weight of 203.33 g/mol, XLogP of 2.64, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylacetic acid;ethane;methanamine is sourced from PubChem (CID 176577797), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).