About 2-cyclohexylacetic acid;N-ethyl-2-methylpropan-1-amine
2-cyclohexylacetic acid;N-ethyl-2-methylpropan-1-amine (PubChem CID 142535514) has the molecular formula C14H29NO2
and a molecular weight of 243.39 g/mol. Its IUPAC name is 2-cyclohexylacetic acid;N-ethyl-2-methylpropan-1-amine.
Molecular Properties
| Compound Name | 2-cyclohexylacetic acid;N-ethyl-2-methylpropan-1-amine |
| PubChem CID | 142535514 |
| Molecular Formula | C14H29NO2 |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.22 |
| IUPAC Name | 2-cyclohexylacetic acid;N-ethyl-2-methylpropan-1-amine |
| SMILES | CCNCC(C)C.O=C(O)CC1CCCCC1 |
| InChI | InChI=1S/C8H14O2.C6H15N/c9-8(10)6-7-4-2-1-3-5-7;1-4-7-5-6(2)3/h7H,1-6H2,(H,9,10);6-7H,4-5H2,1-3H3 |
| InChIKey | WANQTSYUJWGRRY-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexylacetic acid;N-ethyl-2-methylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylacetic acid;N-ethyl-2-methylpropan-1-amine?
The IUPAC name of 2-cyclohexylacetic acid;N-ethyl-2-methylpropan-1-amine (CID 142535514) is 2-cyclohexylacetic acid;N-ethyl-2-methylpropan-1-amine.
What is the SMILES notation for 2-cyclohexylacetic acid;N-ethyl-2-methylpropan-1-amine?
The canonical SMILES for 2-cyclohexylacetic acid;N-ethyl-2-methylpropan-1-amine is CCNCC(C)C.O=C(O)CC1CCCCC1.
What is the InChIKey of 2-cyclohexylacetic acid;N-ethyl-2-methylpropan-1-amine?
The InChIKey is WANQTSYUJWGRRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.C6H15N/c9-8(10)6-7-4-2-1-3-5-7;1-4-7-5-6(2)3/h7H,1-6H2,(H,9,10);6-7H,4-5H2,1-3H3.
What are the key properties of 2-cyclohexylacetic acid;N-ethyl-2-methylpropan-1-amine?
2-cyclohexylacetic acid;N-ethyl-2-methylpropan-1-amine has a molecular weight of 243.39 g/mol, XLogP of 3.29, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylacetic acid;N-ethyl-2-methylpropan-1-amine is sourced from PubChem (CID 142535514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).