About bis(1-benzylimidazolidine-2,4-dione);hexanamide
bis(1-benzylimidazolidine-2,4-dione);hexanamide (PubChem CID 161337897) has the molecular formula C26H33N5O5
and a molecular weight of 495.58 g/mol. Its IUPAC name is bis(1-benzylimidazolidine-2,4-dione);hexanamide.
Molecular Properties
| Compound Name | bis(1-benzylimidazolidine-2,4-dione);hexanamide |
| PubChem CID | 161337897 |
| Molecular Formula | C26H33N5O5 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.25 |
| IUPAC Name | bis(1-benzylimidazolidine-2,4-dione);hexanamide |
| SMILES | CCCCCC(N)=O.O=C1CN(Cc2ccccc2)C(=O)N1.O=C1CN(Cc2ccccc2)C(=O)N1 |
| InChI | InChI=1S/2C10H10N2O2.C6H13NO/c2*13-9-7-12(10(14)11-9)6-8-4-2-1-3-5-8;1-2-3-4-5-6(7)8/h2*1-5H,6-7H2,(H,11,13,14);2-5H2,1H3,(H2,7,8) |
| InChIKey | VMGWLIWYWNJAIY-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 141.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze bis(1-benzylimidazolidine-2,4-dione);hexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-benzylimidazolidine-2,4-dione);hexanamide?
The IUPAC name of bis(1-benzylimidazolidine-2,4-dione);hexanamide (CID 161337897) is bis(1-benzylimidazolidine-2,4-dione);hexanamide.
What is the SMILES notation for bis(1-benzylimidazolidine-2,4-dione);hexanamide?
The canonical SMILES for bis(1-benzylimidazolidine-2,4-dione);hexanamide is CCCCCC(N)=O.O=C1CN(Cc2ccccc2)C(=O)N1.O=C1CN(Cc2ccccc2)C(=O)N1.
What is the InChIKey of bis(1-benzylimidazolidine-2,4-dione);hexanamide?
The InChIKey is VMGWLIWYWNJAIY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C10H10N2O2.C6H13NO/c2*13-9-7-12(10(14)11-9)6-8-4-2-1-3-5-8;1-2-3-4-5-6(7)8/h2*1-5H,6-7H2,(H,11,13,14);2-5H2,1H3,(H2,7,8).
What are the key properties of bis(1-benzylimidazolidine-2,4-dione);hexanamide?
bis(1-benzylimidazolidine-2,4-dione);hexanamide has a molecular weight of 495.58 g/mol, XLogP of 2.53, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-benzylimidazolidine-2,4-dione);hexanamide is sourced from PubChem (CID 161337897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).