About aziridin-2-one;3-(2-phenylethoxy)propanamide
aziridin-2-one;3-(2-phenylethoxy)propanamide (PubChem CID 88919974) has the molecular formula C13H18N2O3
and a molecular weight of 250.30 g/mol. Its IUPAC name is aziridin-2-one;3-(2-phenylethoxy)propanamide.
Molecular Properties
| Compound Name | aziridin-2-one;3-(2-phenylethoxy)propanamide |
| PubChem CID | 88919974 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | aziridin-2-one;3-(2-phenylethoxy)propanamide |
| SMILES | NC(=O)CCOCCc1ccccc1.O=C1CN1 |
| InChI | InChI=1S/C11H15NO2.C2H3NO/c12-11(13)7-9-14-8-6-10-4-2-1-3-5-10;4-2-1-3-2/h1-5H,6-9H2,(H2,12,13);1H2,(H,3,4) |
| InChIKey | VPZDMBQCHNZVLX-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 91.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze aziridin-2-one;3-(2-phenylethoxy)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aziridin-2-one;3-(2-phenylethoxy)propanamide?
The IUPAC name of aziridin-2-one;3-(2-phenylethoxy)propanamide (CID 88919974) is aziridin-2-one;3-(2-phenylethoxy)propanamide.
What is the SMILES notation for aziridin-2-one;3-(2-phenylethoxy)propanamide?
The canonical SMILES for aziridin-2-one;3-(2-phenylethoxy)propanamide is NC(=O)CCOCCc1ccccc1.O=C1CN1.
What is the InChIKey of aziridin-2-one;3-(2-phenylethoxy)propanamide?
The InChIKey is VPZDMBQCHNZVLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.C2H3NO/c12-11(13)7-9-14-8-6-10-4-2-1-3-5-10;4-2-1-3-2/h1-5H,6-9H2,(H2,12,13);1H2,(H,3,4).
What are the key properties of aziridin-2-one;3-(2-phenylethoxy)propanamide?
aziridin-2-one;3-(2-phenylethoxy)propanamide has a molecular weight of 250.30 g/mol, XLogP of 0.24, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aziridin-2-one;3-(2-phenylethoxy)propanamide is sourced from PubChem (CID 88919974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).