About 2-phenylacetamide;1-phenylhexan-1-one
2-phenylacetamide;1-phenylhexan-1-one (PubChem CID 174766102) has the molecular formula C20H25NO2
and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-phenylacetamide;1-phenylhexan-1-one.
Molecular Properties
| Compound Name | 2-phenylacetamide;1-phenylhexan-1-one |
| PubChem CID | 174766102 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-phenylacetamide;1-phenylhexan-1-one |
| SMILES | CCCCCC(=O)c1ccccc1.NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C12H16O.C8H9NO/c1-2-3-5-10-12(13)11-8-6-4-7-9-11;9-8(10)6-7-4-2-1-3-5-7/h4,6-9H,2-3,5,10H2,1H3;1-5H,6H2,(H2,9,10) |
| InChIKey | SWVJVSPQUYRZFA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylacetamide;1-phenylhexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylacetamide;1-phenylhexan-1-one?
The IUPAC name of 2-phenylacetamide;1-phenylhexan-1-one (CID 174766102) is 2-phenylacetamide;1-phenylhexan-1-one.
What is the SMILES notation for 2-phenylacetamide;1-phenylhexan-1-one?
The canonical SMILES for 2-phenylacetamide;1-phenylhexan-1-one is CCCCCC(=O)c1ccccc1.NC(=O)Cc1ccccc1.
What is the InChIKey of 2-phenylacetamide;1-phenylhexan-1-one?
The InChIKey is SWVJVSPQUYRZFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O.C8H9NO/c1-2-3-5-10-12(13)11-8-6-4-7-9-11;9-8(10)6-7-4-2-1-3-5-7/h4,6-9H,2-3,5,10H2,1H3;1-5H,6H2,(H2,9,10).
What are the key properties of 2-phenylacetamide;1-phenylhexan-1-one?
2-phenylacetamide;1-phenylhexan-1-one has a molecular weight of 311.43 g/mol, XLogP of 4.16, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylacetamide;1-phenylhexan-1-one is sourced from PubChem (CID 174766102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).