C13H16N2O3 — CID 174742394
isoindole-1,3-dione;pentanamide (PubChem CID 174742394) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is isoindole-1,3-dione;pentanamide.
| Compound Name | isoindole-1,3-dione;pentanamide |
|---|---|
| PubChem CID | 174742394 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | isoindole-1,3-dione;pentanamide |
| SMILES | CCCCC(N)=O.O=C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H5NO2.C5H11NO/c10-7-5-3-1-2-4-6(5)8(11)9-7;1-2-3-4-5(6)7/h1-4H,(H,9,10,11);2-4H2,1H3,(H2,6,7) |
| InChIKey | ULQRWWXWSBTPAB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|