About isoindole-1,3-dione;tetrabutylphosphanium
isoindole-1,3-dione;tetrabutylphosphanium (PubChem CID 68837365) has the molecular formula C24H41NO2P+
and a molecular weight of 406.57 g/mol. Its IUPAC name is isoindole-1,3-dione;tetrabutylphosphanium.
Molecular Properties
| Compound Name | isoindole-1,3-dione;tetrabutylphosphanium |
| PubChem CID | 68837365 |
| Molecular Formula | C24H41NO2P+ |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | isoindole-1,3-dione;tetrabutylphosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.O=C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C16H36P.C8H5NO2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;10-7-5-3-1-2-4-6(5)8(11)9-7/h5-16H2,1-4H3;1-4H,(H,9,10,11)/q+1; |
| InChIKey | LKWREPCOICZYPW-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze isoindole-1,3-dione;tetrabutylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoindole-1,3-dione;tetrabutylphosphanium?
The IUPAC name of isoindole-1,3-dione;tetrabutylphosphanium (CID 68837365) is isoindole-1,3-dione;tetrabutylphosphanium.
What is the SMILES notation for isoindole-1,3-dione;tetrabutylphosphanium?
The canonical SMILES for isoindole-1,3-dione;tetrabutylphosphanium is CCCC[P+](CCCC)(CCCC)CCCC.O=C1NC(=O)c2ccccc21.
What is the InChIKey of isoindole-1,3-dione;tetrabutylphosphanium?
The InChIKey is LKWREPCOICZYPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36P.C8H5NO2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;10-7-5-3-1-2-4-6(5)8(11)9-7/h5-16H2,1-4H3;1-4H,(H,9,10,11)/q+1;.
What are the key properties of isoindole-1,3-dione;tetrabutylphosphanium?
isoindole-1,3-dione;tetrabutylphosphanium has a molecular weight of 406.57 g/mol, XLogP of 6.77, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for isoindole-1,3-dione;tetrabutylphosphanium is sourced from PubChem (CID 68837365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).