C24H41NO2P+ — CID 68837365
isoindole-1,3-dione;tetrabutylphosphanium (PubChem CID 68837365) has the molecular formula C24H41NO2P+ and a molecular weight of 406.57 g/mol. Its IUPAC name is isoindole-1,3-dione;tetrabutylphosphanium.
| Compound Name | isoindole-1,3-dione;tetrabutylphosphanium |
|---|---|
| PubChem CID | 68837365 |
| Molecular Formula | C24H41NO2P+ |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | isoindole-1,3-dione;tetrabutylphosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.O=C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C16H36P.C8H5NO2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;10-7-5-3-1-2-4-6(5)8(11)9-7/h5-16H2,1-4H3;1-4H,(H,9,10,11)/q+1; |
| InChIKey | LKWREPCOICZYPW-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|