C21H33BrNO2P — CID 22165400
tributyl-[(1,3-dioxoisoindol-2-yl)methyl]phosphanium bromide (PubChem CID 22165400) has the molecular formula C21H33BrNO2P and a molecular weight of 442.38 g/mol. Its IUPAC name is tributyl-[(1,3-dioxoisoindol-2-yl)methyl]phosphanium bromide.
| Compound Name | tributyl-[(1,3-dioxoisoindol-2-yl)methyl]phosphanium bromide |
|---|---|
| PubChem CID | 22165400 |
| Molecular Formula | C21H33BrNO2P |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | tributyl-[(1,3-dioxoisoindol-2-yl)methyl]phosphanium bromide |
| SMILES | CCCC[P+](CCCC)(CCCC)CN1C(=O)c2ccccc2C1=O.[Br-] |
| InChI | InChI=1S/C21H33NO2P.BrH/c1-4-7-14-25(15-8-5-2,16-9-6-3)17-22-20(23)18-12-10-11-13-19(18)21(22)24;/h10-13H,4-9,14-17H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | INOROLXSEQNPCJ-UHFFFAOYSA-M |
| XLogP | 2.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|