C28H33N3O4 — CID 154096403
2-[[decyl-[(1,3-dioxoisoindol-2-yl)methyl]amino]methyl]isoindole-1,3-dione (PubChem CID 154096403) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is 2-[[decyl-[(1,3-dioxoisoindol-2-yl)methyl]amino]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[decyl-[(1,3-dioxoisoindol-2-yl)methyl]amino]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 154096403 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | 2-[[decyl-[(1,3-dioxoisoindol-2-yl)methyl]amino]methyl]isoindole-1,3-dione |
| SMILES | CCCCCCCCCCN(CN1C(=O)c2ccccc2C1=O)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H33N3O4/c1-2-3-4-5-6-7-8-13-18-29(19-30-25(32)21-14-9-10-15-22(21)26(30)33)20-31-27(34)23-16-11-12-17-24(23)28(31)35/h9-12,14-17H,2-8,13,18-20H2,1H3 |
| InChIKey | BNBLFXFYUDCJCC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|