C55H88N4O7 — CID 172572308
butane;6-[3-(1,3-dioxoisoindol-2-yl)propyl-[4-[3-(1,3-dioxoisoindol-2-yl)propyl-(6-hydroxyhexyl)amino]butyl]amino]hexyl 2-pentyloctanoate (PubChem CID 172572308) has the molecular formula C55H88N4O7 and a molecular weight of 917.33 g/mol. Its IUPAC name is butane;6-[3-(1,3-dioxoisoindol-2-yl)propyl-[4-[3-(1,3-dioxoisoindol-2-yl)propyl-(6-hydroxyhexyl)amino]butyl]amino]hexyl 2-pentyloctanoate.
| Compound Name | butane;6-[3-(1,3-dioxoisoindol-2-yl)propyl-[4-[3-(1,3-dioxoisoindol-2-yl)propyl-(6-hydroxyhexyl)amino]butyl]amino]hexyl 2-pentyloctanoate |
|---|---|
| PubChem CID | 172572308 |
| Molecular Formula | C55H88N4O7 |
| Molecular Weight | 917.33 g/mol |
| Exact Mass | 916.67 |
| IUPAC Name | butane;6-[3-(1,3-dioxoisoindol-2-yl)propyl-[4-[3-(1,3-dioxoisoindol-2-yl)propyl-(6-hydroxyhexyl)amino]butyl]amino]hexyl 2-pentyloctanoate |
| SMILES | CCCC.CCCCCCC(CCCCC)C(=O)OCCCCCCN(CCCCN(CCCCCCO)CCCN1C(=O)c2ccccc2C1=O)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C51H78N4O7.C4H10/c1-3-5-7-13-27-42(26-12-6-4-2)51(61)62-41-23-11-9-19-33-53(37-25-39-55-49(59)45-30-16-17-31-46(45)50(55)60)35-21-20-34-52(32-18-8-10-22-40-56)36-24-38-54-47(57)43-28-14-15-29-44(43)48(54)58;1-3-4-2/h14-17,28-31,42,56H,3-13,18-27,32-41H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | JFEUZAIOOBBAIV-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 127.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.33 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|