C52H90N2O6 — CID 126717392
nonyl 8-[2-(1,3-dioxoisoindol-2-yl)ethyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate (PubChem CID 126717392) has the molecular formula C52H90N2O6 and a molecular weight of 839.30 g/mol. Its IUPAC name is nonyl 8-[2-(1,3-dioxoisoindol-2-yl)ethyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate.
| Compound Name | nonyl 8-[2-(1,3-dioxoisoindol-2-yl)ethyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
|---|---|
| PubChem CID | 126717392 |
| Molecular Formula | C52H90N2O6 |
| Molecular Weight | 839.30 g/mol |
| Exact Mass | 838.68 |
| IUPAC Name | nonyl 8-[2-(1,3-dioxoisoindol-2-yl)ethyl-(8-heptadecan-9-yloxy-8-oxooctyl)amino]octanoate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C52H90N2O6/c1-4-7-10-13-16-25-34-45-59-49(55)39-28-21-17-23-32-41-53(43-44-54-51(57)47-37-30-31-38-48(47)52(54)58)42-33-24-18-22-29-40-50(56)60-46(35-26-19-14-11-8-5-2)36-27-20-15-12-9-6-3/h30-31,37-38,46H,4-29,32-36,39-45H2,1-3H3 |
| InChIKey | AODRSWBYNVOZGB-UHFFFAOYSA-N |
| XLogP | 13.97 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.30 |
| LogP ≤ 5 | 13.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|