C49H91N3O6 — CID 170368569
octyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-(3-methyl-2,4-dioxopyrimidin-1-yl)propyl]amino]octanoate (PubChem CID 170368569) has the molecular formula C49H91N3O6 and a molecular weight of 818.28 g/mol. Its IUPAC name is octyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-(3-methyl-2,4-dioxopyrimidin-1-yl)propyl]amino]octanoate.
| Compound Name | octyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-(3-methyl-2,4-dioxopyrimidin-1-yl)propyl]amino]octanoate |
|---|---|
| PubChem CID | 170368569 |
| Molecular Formula | C49H91N3O6 |
| Molecular Weight | 818.28 g/mol |
| Exact Mass | 817.69 |
| IUPAC Name | octyl 8-[(8-heptadecan-9-yloxy-8-oxooctyl)-[3-(3-methyl-2,4-dioxopyrimidin-1-yl)propyl]amino]octanoate |
| SMILES | CCCCCCCCOC(=O)CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCn1ccc(=O)n(C)c1=O |
| InChI | InChI=1S/C49H91N3O6/c1-5-8-11-14-19-26-34-45(35-27-20-15-12-9-6-2)58-48(55)37-29-22-18-24-31-40-51(41-33-42-52-43-38-46(53)50(4)49(52)56)39-30-23-17-21-28-36-47(54)57-44-32-25-16-13-10-7-3/h38,43,45H,5-37,39-42,44H2,1-4H3 |
| InChIKey | OQNGEQBCAKWATI-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 99.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.28 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|