C49H92N4O4 — CID 126717578
heptadecan-9-yl 8-[3-(4-amino-2-oxopyrimidin-1-yl)propyl-(8-octoxynon-8-enyl)amino]octanoate (PubChem CID 126717578) has the molecular formula C49H92N4O4 and a molecular weight of 801.30 g/mol. Its IUPAC name is heptadecan-9-yl 8-[3-(4-amino-2-oxopyrimidin-1-yl)propyl-(8-octoxynon-8-enyl)amino]octanoate.
| Compound Name | heptadecan-9-yl 8-[3-(4-amino-2-oxopyrimidin-1-yl)propyl-(8-octoxynon-8-enyl)amino]octanoate |
|---|---|
| PubChem CID | 126717578 |
| Molecular Formula | C49H92N4O4 |
| Molecular Weight | 801.30 g/mol |
| Exact Mass | 800.71 |
| IUPAC Name | heptadecan-9-yl 8-[3-(4-amino-2-oxopyrimidin-1-yl)propyl-(8-octoxynon-8-enyl)amino]octanoate |
| SMILES | C=C(CCCCCCCN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCn1ccc(N)nc1=O)OCCCCCCCC |
| InChI | InChI=1S/C49H92N4O4/c1-5-8-11-14-20-27-35-46(36-28-21-15-12-9-6-2)57-48(54)37-29-22-18-24-31-40-52(41-33-42-53-43-38-47(50)51-49(53)55)39-30-23-17-19-26-34-45(4)56-44-32-25-16-13-10-7-3/h38,43,46H,4-37,39-42,44H2,1-3H3,(H2,50,51,55) |
| InChIKey | QOZKHWMKIHHPEJ-UHFFFAOYSA-N |
| XLogP | 13.50 |
| TPSA | 99.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.30 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|