C23H28N2O2 — CID 22067483
2-[2-[benzyl(hexyl)amino]ethyl]isoindole-1,3-dione (PubChem CID 22067483) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 2-[2-[benzyl(hexyl)amino]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[benzyl(hexyl)amino]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 22067483 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 2-[2-[benzyl(hexyl)amino]ethyl]isoindole-1,3-dione |
| SMILES | CCCCCCN(CCN1C(=O)c2ccccc2C1=O)Cc1ccccc1 |
| InChI | InChI=1S/C23H28N2O2/c1-2-3-4-10-15-24(18-19-11-6-5-7-12-19)16-17-25-22(26)20-13-8-9-14-21(20)23(25)27/h5-9,11-14H,2-4,10,15-18H2,1H3 |
| InChIKey | LOOFQIVGISPBFZ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|