C27H28N4O4 — CID 19811078
7-[bis[2-(1,3-dioxoisoindol-2-yl)ethyl]amino]heptanenitrile (PubChem CID 19811078) has the molecular formula C27H28N4O4 and a molecular weight of 472.55 g/mol. Its IUPAC name is 7-[bis[2-(1,3-dioxoisoindol-2-yl)ethyl]amino]heptanenitrile.
| Compound Name | 7-[bis[2-(1,3-dioxoisoindol-2-yl)ethyl]amino]heptanenitrile |
|---|---|
| PubChem CID | 19811078 |
| Molecular Formula | C27H28N4O4 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | 7-[bis[2-(1,3-dioxoisoindol-2-yl)ethyl]amino]heptanenitrile |
| SMILES | N#CCCCCCCN(CCN1C(=O)c2ccccc2C1=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H28N4O4/c28-14-8-2-1-3-9-15-29(16-18-30-24(32)20-10-4-5-11-21(20)25(30)33)17-19-31-26(34)22-12-6-7-13-23(22)27(31)35/h4-7,10-13H,1-3,8-9,15-19H2 |
| InChIKey | AAMXCRIJWOPOHH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 101.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|