C26H42N2O2 — CID 170273237
2-[2-(dioctylamino)ethyl]isoindole-1,3-dione (PubChem CID 170273237) has the molecular formula C26H42N2O2 and a molecular weight of 414.63 g/mol. Its IUPAC name is 2-[2-(dioctylamino)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(dioctylamino)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 170273237 |
| Molecular Formula | C26H42N2O2 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 414.32 |
| IUPAC Name | 2-[2-(dioctylamino)ethyl]isoindole-1,3-dione |
| SMILES | CCCCCCCCN(CCCCCCCC)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H42N2O2/c1-3-5-7-9-11-15-19-27(20-16-12-10-8-6-4-2)21-22-28-25(29)23-17-13-14-18-24(23)26(28)30/h13-14,17-18H,3-12,15-16,19-22H2,1-2H3 |
| InChIKey | TVRXIAXBNCVLGW-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|