C22H43O3P — CID 68855891
benzene-1,2-diol;tetrabutylphosphanium;hydroxide (PubChem CID 68855891) has the molecular formula C22H43O3P and a molecular weight of 386.56 g/mol. Its IUPAC name is benzene-1,2-diol;tetrabutylphosphanium;hydroxide.
| Compound Name | benzene-1,2-diol;tetrabutylphosphanium;hydroxide |
|---|---|
| PubChem CID | 68855891 |
| Molecular Formula | C22H43O3P |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.29 |
| IUPAC Name | benzene-1,2-diol;tetrabutylphosphanium;hydroxide |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.Oc1ccccc1O.[OH-] |
| InChI | InChI=1S/C16H36P.C6H6O2.H2O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;7-5-3-1-2-4-6(5)8;/h5-16H2,1-4H3;1-4,7-8H;1H2/q+1;;/p-1 |
| InChIKey | QDHOJOGOLCFMGZ-UHFFFAOYSA-M |
| XLogP | 7.13 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|