About 2-(2-methylhexyl)phenol
2-(2-methylhexyl)phenol (PubChem CID 70468814) has the molecular formula C13H20O
and a molecular weight of 192.30 g/mol. Its IUPAC name is 2-(2-methylhexyl)phenol.
Molecular Properties
| Compound Name | 2-(2-methylhexyl)phenol |
| PubChem CID | 70468814 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 2-(2-methylhexyl)phenol |
| SMILES | CCCCC(C)Cc1ccccc1O |
| InChI | InChI=1S/C13H20O/c1-3-4-7-11(2)10-12-8-5-6-9-13(12)14/h5-6,8-9,11,14H,3-4,7,10H2,1-2H3 |
| InChIKey | IBCCSJIHEACVOE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-methylhexyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylhexyl)phenol?
The IUPAC name of 2-(2-methylhexyl)phenol (CID 70468814) is 2-(2-methylhexyl)phenol.
What is the SMILES notation for 2-(2-methylhexyl)phenol?
The canonical SMILES for 2-(2-methylhexyl)phenol is CCCCC(C)Cc1ccccc1O.
What is the InChIKey of 2-(2-methylhexyl)phenol?
The InChIKey is IBCCSJIHEACVOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O/c1-3-4-7-11(2)10-12-8-5-6-9-13(12)14/h5-6,8-9,11,14H,3-4,7,10H2,1-2H3.
What are the key properties of 2-(2-methylhexyl)phenol?
2-(2-methylhexyl)phenol has a molecular weight of 192.30 g/mol, XLogP of 3.76, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylhexyl)phenol is sourced from PubChem (CID 70468814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).