C20H34S — CID 175261112
2-(2,4-dimethyldodecyl)benzenethiol (PubChem CID 175261112) has the molecular formula C20H34S and a molecular weight of 306.56 g/mol. Its IUPAC name is 2-(2,4-dimethyldodecyl)benzenethiol.
| Compound Name | 2-(2,4-dimethyldodecyl)benzenethiol |
|---|---|
| PubChem CID | 175261112 |
| Molecular Formula | C20H34S |
| Molecular Weight | 306.56 g/mol |
| Exact Mass | 306.24 |
| IUPAC Name | 2-(2,4-dimethyldodecyl)benzenethiol |
| SMILES | CCCCCCCCC(C)CC(C)Cc1ccccc1S |
| InChI | InChI=1S/C20H34S/c1-4-5-6-7-8-9-12-17(2)15-18(3)16-19-13-10-11-14-20(19)21/h10-11,13-14,17-18,21H,4-9,12,15-16H2,1-3H3 |
| InChIKey | GQACCNFFGXNURQ-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.56 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|