About 2-(2-methylpropyl)phenol;propane
2-(2-methylpropyl)phenol;propane (PubChem CID 158609255) has the molecular formula C13H22O
and a molecular weight of 194.32 g/mol. Its IUPAC name is 2-(2-methylpropyl)phenol;propane.
Molecular Properties
| Compound Name | 2-(2-methylpropyl)phenol;propane |
| PubChem CID | 158609255 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | 2-(2-methylpropyl)phenol;propane |
| SMILES | CC(C)Cc1ccccc1O.CCC |
| InChI | InChI=1S/C10H14O.C3H8/c1-8(2)7-9-5-3-4-6-10(9)11;1-3-2/h3-6,8,11H,7H2,1-2H3;3H2,1-2H3 |
| InChIKey | HWPWGORZJIMNIM-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-methylpropyl)phenol;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpropyl)phenol;propane?
The IUPAC name of 2-(2-methylpropyl)phenol;propane (CID 158609255) is 2-(2-methylpropyl)phenol;propane.
What is the SMILES notation for 2-(2-methylpropyl)phenol;propane?
The canonical SMILES for 2-(2-methylpropyl)phenol;propane is CC(C)Cc1ccccc1O.CCC.
What is the InChIKey of 2-(2-methylpropyl)phenol;propane?
The InChIKey is HWPWGORZJIMNIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O.C3H8/c1-8(2)7-9-5-3-4-6-10(9)11;1-3-2/h3-6,8,11H,7H2,1-2H3;3H2,1-2H3.
What are the key properties of 2-(2-methylpropyl)phenol;propane?
2-(2-methylpropyl)phenol;propane has a molecular weight of 194.32 g/mol, XLogP of 4.01, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpropyl)phenol;propane is sourced from PubChem (CID 158609255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).