C10H16N2O — CID 134347246
2-(2,3-diaminobutyl)phenol (PubChem CID 134347246) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 2-(2,3-diaminobutyl)phenol.
| Compound Name | 2-(2,3-diaminobutyl)phenol |
|---|---|
| PubChem CID | 134347246 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 2-(2,3-diaminobutyl)phenol |
| SMILES | CC(N)C(N)Cc1ccccc1O |
| InChI | InChI=1S/C10H16N2O/c1-7(11)9(12)6-8-4-2-3-5-10(8)13/h2-5,7,9,13H,6,11-12H2,1H3 |
| InChIKey | PTYSJMDPRSVCEY-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |