C14H24O — CID 172819121
1,2-bis(2-methylpropyl)benzene;hydrate (PubChem CID 172819121) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 1,2-bis(2-methylpropyl)benzene;hydrate.
| Compound Name | 1,2-bis(2-methylpropyl)benzene;hydrate |
|---|---|
| PubChem CID | 172819121 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 1,2-bis(2-methylpropyl)benzene;hydrate |
| SMILES | CC(C)Cc1ccccc1CC(C)C.O |
| InChI | InChI=1S/C14H22.H2O/c1-11(2)9-13-7-5-6-8-14(13)10-12(3)4;/h5-8,11-12H,9-10H2,1-4H3;1H2 |
| InChIKey | WHXJNIJIANETKU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |