About azane;[2-(2-methylpropyl)phenyl]methanamine
azane;[2-(2-methylpropyl)phenyl]methanamine (PubChem CID 174953175) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is azane;[2-(2-methylpropyl)phenyl]methanamine.
Molecular Properties
| Compound Name | azane;[2-(2-methylpropyl)phenyl]methanamine |
| PubChem CID | 174953175 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | azane;[2-(2-methylpropyl)phenyl]methanamine |
| SMILES | CC(C)Cc1ccccc1CN.N |
| InChI | InChI=1S/C11H17N.H3N/c1-9(2)7-10-5-3-4-6-11(10)8-12;/h3-6,9H,7-8,12H2,1-2H3;1H3 |
| InChIKey | WNJRPIPODVKWCB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;[2-(2-methylpropyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;[2-(2-methylpropyl)phenyl]methanamine?
The IUPAC name of azane;[2-(2-methylpropyl)phenyl]methanamine (CID 174953175) is azane;[2-(2-methylpropyl)phenyl]methanamine.
What is the SMILES notation for azane;[2-(2-methylpropyl)phenyl]methanamine?
The canonical SMILES for azane;[2-(2-methylpropyl)phenyl]methanamine is CC(C)Cc1ccccc1CN.N.
What is the InChIKey of azane;[2-(2-methylpropyl)phenyl]methanamine?
The InChIKey is WNJRPIPODVKWCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N.H3N/c1-9(2)7-10-5-3-4-6-11(10)8-12;/h3-6,9H,7-8,12H2,1-2H3;1H3.
What are the key properties of azane;[2-(2-methylpropyl)phenyl]methanamine?
azane;[2-(2-methylpropyl)phenyl]methanamine has a molecular weight of 180.29 g/mol, XLogP of 2.51, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;[2-(2-methylpropyl)phenyl]methanamine is sourced from PubChem (CID 174953175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).