About benzene;2-ethylphenol
benzene;2-ethylphenol (PubChem CID 159726745) has the molecular formula C14H16O
and a molecular weight of 200.28 g/mol. Its IUPAC name is benzene;2-ethylphenol.
Molecular Properties
| Compound Name | benzene;2-ethylphenol |
| PubChem CID | 159726745 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | benzene;2-ethylphenol |
| SMILES | CCc1ccccc1O.c1ccccc1 |
| InChI | InChI=1S/C8H10O.C6H6/c1-2-7-5-3-4-6-8(7)9;1-2-4-6-5-3-1/h3-6,9H,2H2,1H3;1-6H |
| InChIKey | NASPPUKURYESFJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzene;2-ethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;2-ethylphenol?
The IUPAC name of benzene;2-ethylphenol (CID 159726745) is benzene;2-ethylphenol.
What is the SMILES notation for benzene;2-ethylphenol?
The canonical SMILES for benzene;2-ethylphenol is CCc1ccccc1O.c1ccccc1.
What is the InChIKey of benzene;2-ethylphenol?
The InChIKey is NASPPUKURYESFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.C6H6/c1-2-7-5-3-4-6-8(7)9;1-2-4-6-5-3-1/h3-6,9H,2H2,1H3;1-6H.
What are the key properties of benzene;2-ethylphenol?
benzene;2-ethylphenol has a molecular weight of 200.28 g/mol, XLogP of 3.64, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;2-ethylphenol is sourced from PubChem (CID 159726745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).