About 2-ethylphenol;2-phenylethanol
2-ethylphenol;2-phenylethanol (PubChem CID 157102342) has the molecular formula C16H20O2
and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-ethylphenol;2-phenylethanol.
Molecular Properties
| Compound Name | 2-ethylphenol;2-phenylethanol |
| PubChem CID | 157102342 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 2-ethylphenol;2-phenylethanol |
| SMILES | CCc1ccccc1O.OCCc1ccccc1 |
| InChI | InChI=1S/2C8H10O/c1-2-7-5-3-4-6-8(7)9;9-7-6-8-4-2-1-3-5-8/h3-6,9H,2H2,1H3;1-5,9H,6-7H2 |
| InChIKey | AFXFNLYMSGDWJO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylphenol;2-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylphenol;2-phenylethanol?
The IUPAC name of 2-ethylphenol;2-phenylethanol (CID 157102342) is 2-ethylphenol;2-phenylethanol.
What is the SMILES notation for 2-ethylphenol;2-phenylethanol?
The canonical SMILES for 2-ethylphenol;2-phenylethanol is CCc1ccccc1O.OCCc1ccccc1.
What is the InChIKey of 2-ethylphenol;2-phenylethanol?
The InChIKey is AFXFNLYMSGDWJO-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H10O/c1-2-7-5-3-4-6-8(7)9;9-7-6-8-4-2-1-3-5-8/h3-6,9H,2H2,1H3;1-5,9H,6-7H2.
What are the key properties of 2-ethylphenol;2-phenylethanol?
2-ethylphenol;2-phenylethanol has a molecular weight of 244.33 g/mol, XLogP of 3.18, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylphenol;2-phenylethanol is sourced from PubChem (CID 157102342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).