About 2-(hydroxymethyl)phenol;pentane
2-(hydroxymethyl)phenol;pentane (PubChem CID 70619203) has the molecular formula C12H20O2
and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-(hydroxymethyl)phenol;pentane.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)phenol;pentane |
| PubChem CID | 70619203 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 2-(hydroxymethyl)phenol;pentane |
| SMILES | CCCCC.OCc1ccccc1O |
| InChI | InChI=1S/C7H8O2.C5H12/c8-5-6-3-1-2-4-7(6)9;1-3-5-4-2/h1-4,8-9H,5H2;3-5H2,1-2H3 |
| InChIKey | NMSLGMBIWLLZSJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(hydroxymethyl)phenol;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)phenol;pentane?
The IUPAC name of 2-(hydroxymethyl)phenol;pentane (CID 70619203) is 2-(hydroxymethyl)phenol;pentane.
What is the SMILES notation for 2-(hydroxymethyl)phenol;pentane?
The canonical SMILES for 2-(hydroxymethyl)phenol;pentane is CCCCC.OCc1ccccc1O.
What is the InChIKey of 2-(hydroxymethyl)phenol;pentane?
The InChIKey is NMSLGMBIWLLZSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2.C5H12/c8-5-6-3-1-2-4-7(6)9;1-3-5-4-2/h1-4,8-9H,5H2;3-5H2,1-2H3.
What are the key properties of 2-(hydroxymethyl)phenol;pentane?
2-(hydroxymethyl)phenol;pentane has a molecular weight of 196.29 g/mol, XLogP of 3.08, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)phenol;pentane is sourced from PubChem (CID 70619203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).