About 2-(4-fluorooctyl)phenol
2-(4-fluorooctyl)phenol (PubChem CID 70022648) has the molecular formula C14H21FO
and a molecular weight of 224.32 g/mol. Its IUPAC name is 2-(4-fluorooctyl)phenol.
Molecular Properties
| Compound Name | 2-(4-fluorooctyl)phenol |
| PubChem CID | 70022648 |
| Molecular Formula | C14H21FO |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 2-(4-fluorooctyl)phenol |
| SMILES | CCCCC(F)CCCc1ccccc1O |
| InChI | InChI=1S/C14H21FO/c1-2-3-9-13(15)10-6-8-12-7-4-5-11-14(12)16/h4-5,7,11,13,16H,2-3,6,8-10H2,1H3 |
| InChIKey | CZFUCAXWTMTXMX-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-fluorooctyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-fluorooctyl)phenol?
The IUPAC name of 2-(4-fluorooctyl)phenol (CID 70022648) is 2-(4-fluorooctyl)phenol.
What is the SMILES notation for 2-(4-fluorooctyl)phenol?
The canonical SMILES for 2-(4-fluorooctyl)phenol is CCCCC(F)CCCc1ccccc1O.
What is the InChIKey of 2-(4-fluorooctyl)phenol?
The InChIKey is CZFUCAXWTMTXMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21FO/c1-2-3-9-13(15)10-6-8-12-7-4-5-11-14(12)16/h4-5,7,11,13,16H,2-3,6,8-10H2,1H3.
What are the key properties of 2-(4-fluorooctyl)phenol?
2-(4-fluorooctyl)phenol has a molecular weight of 224.32 g/mol, XLogP of 4.24, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-fluorooctyl)phenol is sourced from PubChem (CID 70022648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).