About phenol;tetrabutylphosphanium
phenol;tetrabutylphosphanium (PubChem CID 20524943) has the molecular formula C28H48O2P+
and a molecular weight of 447.66 g/mol. Its IUPAC name is phenol;tetrabutylphosphanium.
Molecular Properties
| Compound Name | phenol;tetrabutylphosphanium |
| PubChem CID | 20524943 |
| Molecular Formula | C28H48O2P+ |
| Molecular Weight | 447.66 g/mol |
| Exact Mass | 447.34 |
| IUPAC Name | phenol;tetrabutylphosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)CCCC.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C16H36P.2C6H6O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2*7-6-4-2-1-3-5-6/h5-16H2,1-4H3;2*1-5,7H/q+1;; |
| InChIKey | IJQDHNMZNQTJBW-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 447.66 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phenol;tetrabutylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenol;tetrabutylphosphanium?
The IUPAC name of phenol;tetrabutylphosphanium (CID 20524943) is phenol;tetrabutylphosphanium.
What is the SMILES notation for phenol;tetrabutylphosphanium?
The canonical SMILES for phenol;tetrabutylphosphanium is CCCC[P+](CCCC)(CCCC)CCCC.Oc1ccccc1.Oc1ccccc1.
What is the InChIKey of phenol;tetrabutylphosphanium?
The InChIKey is IJQDHNMZNQTJBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36P.2C6H6O/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2*7-6-4-2-1-3-5-6/h5-16H2,1-4H3;2*1-5,7H/q+1;;.
What are the key properties of phenol;tetrabutylphosphanium?
phenol;tetrabutylphosphanium has a molecular weight of 447.66 g/mol, XLogP of 8.99, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenol;tetrabutylphosphanium is sourced from PubChem (CID 20524943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).