About hexane-1,1-diamine;phenol
hexane-1,1-diamine;phenol (PubChem CID 174607848) has the molecular formula C12H22N2O
and a molecular weight of 210.32 g/mol. Its IUPAC name is hexane-1,1-diamine;phenol.
Molecular Properties
| Compound Name | hexane-1,1-diamine;phenol |
| PubChem CID | 174607848 |
| Molecular Formula | C12H22N2O |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.17 |
| IUPAC Name | hexane-1,1-diamine;phenol |
| SMILES | CCCCCC(N)N.Oc1ccccc1 |
| InChI | InChI=1S/C6H16N2.C6H6O/c1-2-3-4-5-6(7)8;7-6-4-2-1-3-5-6/h6H,2-5,7-8H2,1H3;1-5,7H |
| InChIKey | PFKQLOKESGYJQP-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze hexane-1,1-diamine;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexane-1,1-diamine;phenol?
The IUPAC name of hexane-1,1-diamine;phenol (CID 174607848) is hexane-1,1-diamine;phenol.
What is the SMILES notation for hexane-1,1-diamine;phenol?
The canonical SMILES for hexane-1,1-diamine;phenol is CCCCCC(N)N.Oc1ccccc1.
What is the InChIKey of hexane-1,1-diamine;phenol?
The InChIKey is PFKQLOKESGYJQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2.C6H6O/c1-2-3-4-5-6(7)8;7-6-4-2-1-3-5-6/h6H,2-5,7-8H2,1H3;1-5,7H.
What are the key properties of hexane-1,1-diamine;phenol?
hexane-1,1-diamine;phenol has a molecular weight of 210.32 g/mol, XLogP of 2.20, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexane-1,1-diamine;phenol is sourced from PubChem (CID 174607848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).