About N,N-dibutylbutan-1-amine;phenol
N,N-dibutylbutan-1-amine;phenol (PubChem CID 172785095) has the molecular formula C36H51NO4
and a molecular weight of 561.81 g/mol. Its IUPAC name is N,N-dibutylbutan-1-amine;phenol.
Molecular Properties
| Compound Name | N,N-dibutylbutan-1-amine;phenol |
| PubChem CID | 172785095 |
| Molecular Formula | C36H51NO4 |
| Molecular Weight | 561.81 g/mol |
| Exact Mass | 561.38 |
| IUPAC Name | N,N-dibutylbutan-1-amine;phenol |
| SMILES | CCCCN(CCCC)CCCC.Oc1ccccc1.Oc1ccccc1.Oc1ccccc1.Oc1ccccc1 |
| InChI | InChI=1S/C12H27N.4C6H6O/c1-4-7-10-13(11-8-5-2)12-9-6-3;4*7-6-4-2-1-3-5-6/h4-12H2,1-3H3;4*1-5,7H |
| InChIKey | OUCCYGNQFLZRPM-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 561.81 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-dibutylbutan-1-amine;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibutylbutan-1-amine;phenol?
The IUPAC name of N,N-dibutylbutan-1-amine;phenol (CID 172785095) is N,N-dibutylbutan-1-amine;phenol.
What is the SMILES notation for N,N-dibutylbutan-1-amine;phenol?
The canonical SMILES for N,N-dibutylbutan-1-amine;phenol is CCCCN(CCCC)CCCC.Oc1ccccc1.Oc1ccccc1.Oc1ccccc1.Oc1ccccc1.
What is the InChIKey of N,N-dibutylbutan-1-amine;phenol?
The InChIKey is OUCCYGNQFLZRPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.4C6H6O/c1-4-7-10-13(11-8-5-2)12-9-6-3;4*7-6-4-2-1-3-5-6/h4-12H2,1-3H3;4*1-5,7H.
What are the key properties of N,N-dibutylbutan-1-amine;phenol?
N,N-dibutylbutan-1-amine;phenol has a molecular weight of 561.81 g/mol, XLogP of 9.26, 9 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibutylbutan-1-amine;phenol is sourced from PubChem (CID 172785095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).