About bromomethane;isoindole-1,3-dione
bromomethane;isoindole-1,3-dione (PubChem CID 158684384) has the molecular formula C9H8BrNO2
and a molecular weight of 242.07 g/mol. Its IUPAC name is bromomethane;isoindole-1,3-dione.
Molecular Properties
| Compound Name | bromomethane;isoindole-1,3-dione |
| PubChem CID | 158684384 |
| Molecular Formula | C9H8BrNO2 |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 240.97 |
| IUPAC Name | bromomethane;isoindole-1,3-dione |
| SMILES | CBr.O=C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H5NO2.CH3Br/c10-7-5-3-1-2-4-6(5)8(11)9-7;1-2/h1-4H,(H,9,10,11);1H3 |
| InChIKey | IFNVLOSVQDWUHI-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze bromomethane;isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromomethane;isoindole-1,3-dione?
The IUPAC name of bromomethane;isoindole-1,3-dione (CID 158684384) is bromomethane;isoindole-1,3-dione.
What is the SMILES notation for bromomethane;isoindole-1,3-dione?
The canonical SMILES for bromomethane;isoindole-1,3-dione is CBr.O=C1NC(=O)c2ccccc21.
What is the InChIKey of bromomethane;isoindole-1,3-dione?
The InChIKey is IFNVLOSVQDWUHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2.CH3Br/c10-7-5-3-1-2-4-6(5)8(11)9-7;1-2/h1-4H,(H,9,10,11);1H3.
What are the key properties of bromomethane;isoindole-1,3-dione?
bromomethane;isoindole-1,3-dione has a molecular weight of 242.07 g/mol, XLogP of 1.58, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bromomethane;isoindole-1,3-dione is sourced from PubChem (CID 158684384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).