About dipotassium;hydride;isoindole-1,3-dione
dipotassium;hydride;isoindole-1,3-dione (PubChem CID 173033461) has the molecular formula C8H7K2NO2
and a molecular weight of 227.35 g/mol. Its IUPAC name is dipotassium;hydride;isoindole-1,3-dione.
Molecular Properties
| Compound Name | dipotassium;hydride;isoindole-1,3-dione |
| PubChem CID | 173033461 |
| Molecular Formula | C8H7K2NO2 |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 226.98 |
| IUPAC Name | dipotassium;hydride;isoindole-1,3-dione |
| SMILES | O=C1NC(=O)c2ccccc21.[H-].[H-].[K+].[K+] |
| InChI | InChI=1S/C8H5NO2.2K.2H/c10-7-5-3-1-2-4-6(5)8(11)9-7;;;;/h1-4H,(H,9,10,11);;;;/q;2*+1;2*-1 |
| InChIKey | WUKYWAIAOAYJSN-UHFFFAOYSA-N |
| XLogP | -5.20 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | -5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze dipotassium;hydride;isoindole-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipotassium;hydride;isoindole-1,3-dione?
The IUPAC name of dipotassium;hydride;isoindole-1,3-dione (CID 173033461) is dipotassium;hydride;isoindole-1,3-dione.
What is the SMILES notation for dipotassium;hydride;isoindole-1,3-dione?
The canonical SMILES for dipotassium;hydride;isoindole-1,3-dione is O=C1NC(=O)c2ccccc21.[H-].[H-].[K+].[K+].
What is the InChIKey of dipotassium;hydride;isoindole-1,3-dione?
The InChIKey is WUKYWAIAOAYJSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO2.2K.2H/c10-7-5-3-1-2-4-6(5)8(11)9-7;;;;/h1-4H,(H,9,10,11);;;;/q;2*+1;2*-1.
What are the key properties of dipotassium;hydride;isoindole-1,3-dione?
dipotassium;hydride;isoindole-1,3-dione has a molecular weight of 227.35 g/mol, XLogP of -5.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dipotassium;hydride;isoindole-1,3-dione is sourced from PubChem (CID 173033461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).