About acetamide;pentanamide
acetamide;pentanamide (PubChem CID 158041283) has the molecular formula C7H16N2O2
and a molecular weight of 160.22 g/mol. Its IUPAC name is acetamide;pentanamide.
Molecular Properties
| Compound Name | acetamide;pentanamide |
| PubChem CID | 158041283 |
| Molecular Formula | C7H16N2O2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.12 |
| IUPAC Name | acetamide;pentanamide |
| SMILES | CC(N)=O.CCCCC(N)=O |
| InChI | InChI=1S/C5H11NO.C2H5NO/c1-2-3-4-5(6)7;1-2(3)4/h2-4H2,1H3,(H2,6,7);1H3,(H2,3,4) |
| InChIKey | FIJOWZZNEDMJMC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetamide;pentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetamide;pentanamide?
The IUPAC name of acetamide;pentanamide (CID 158041283) is acetamide;pentanamide.
What is the SMILES notation for acetamide;pentanamide?
The canonical SMILES for acetamide;pentanamide is CC(N)=O.CCCCC(N)=O.
What is the InChIKey of acetamide;pentanamide?
The InChIKey is FIJOWZZNEDMJMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C2H5NO/c1-2-3-4-5(6)7;1-2(3)4/h2-4H2,1H3,(H2,6,7);1H3,(H2,3,4).
What are the key properties of acetamide;pentanamide?
acetamide;pentanamide has a molecular weight of 160.22 g/mol, XLogP of 0.15, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetamide;pentanamide is sourced from PubChem (CID 158041283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).