C12H9NO6 — CID 69393204
(Z)-but-2-enedioic acid;isoindole-1,3-dione (PubChem CID 69393204) has the molecular formula C12H9NO6 and a molecular weight of 263.21 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;isoindole-1,3-dione.
| Compound Name | (Z)-but-2-enedioic acid;isoindole-1,3-dione |
|---|---|
| PubChem CID | 69393204 |
| Molecular Formula | C12H9NO6 |
| Molecular Weight | 263.21 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | (Z)-but-2-enedioic acid;isoindole-1,3-dione |
| SMILES | O=C(O)/C=C\C(=O)O.O=C1NC(=O)c2ccccc21 |
| InChI | InChI=1S/C8H5NO2.C4H4O4/c10-7-5-3-1-2-4-6(5)8(11)9-7;5-3(6)1-2-4(7)8/h1-4H,(H,9,10,11);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | NWPYAKWXPBVIDT-BTJKTKAUSA-N |
| XLogP | 0.28 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.21 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|