About potassium isoindol-2-ide-1,3-dione
potassium isoindol-2-ide-1,3-dione (PubChem CID 3356745) has the molecular formula C8H4KNO2
and a molecular weight of 185.22 g/mol. Its IUPAC name is potassium isoindol-2-ide-1,3-dione.
Molecular Properties
| Compound Name | potassium isoindol-2-ide-1,3-dione |
| PubChem CID | 3356745 |
| Molecular Formula | C8H4KNO2 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 184.99 |
| IUPAC Name | potassium isoindol-2-ide-1,3-dione |
| SMILES | O=C1[N-]C(=O)c2ccccc21.[K+] |
| InChI | InChI=1S/C8H5NO2.K/c10-7-5-3-1-2-4-6(5)8(11)9-7;/h1-4H,(H,9,10,11);/q;+1/p-1 |
| InChIKey | FYRHIOVKTDQVFC-UHFFFAOYSA-M |
| XLogP | -1.64 |
| TPSA | 48.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze potassium isoindol-2-ide-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium isoindol-2-ide-1,3-dione?
The IUPAC name of potassium isoindol-2-ide-1,3-dione (CID 3356745) is potassium isoindol-2-ide-1,3-dione.
What is the SMILES notation for potassium isoindol-2-ide-1,3-dione?
The canonical SMILES for potassium isoindol-2-ide-1,3-dione is O=C1[N-]C(=O)c2ccccc21.[K+].
What is the InChIKey of potassium isoindol-2-ide-1,3-dione?
The InChIKey is FYRHIOVKTDQVFC-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H5NO2.K/c10-7-5-3-1-2-4-6(5)8(11)9-7;/h1-4H,(H,9,10,11);/q;+1/p-1.
What are the key properties of potassium isoindol-2-ide-1,3-dione?
potassium isoindol-2-ide-1,3-dione has a molecular weight of 185.22 g/mol, XLogP of -1.64, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium isoindol-2-ide-1,3-dione is sourced from PubChem (CID 3356745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).