C21H34ClN3O2 — CID 120649189
N-(3-aminopropyl)-N-benzyl-2-[(2-cyclohexylacetyl)amino]propanamide;hydrochloride (PubChem CID 120649189) has the molecular formula C21H34ClN3O2 and a molecular weight of 395.98 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-benzyl-2-[(2-cyclohexylacetyl)amino]propanamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-N-benzyl-2-[(2-cyclohexylacetyl)amino]propanamide;hydrochloride |
|---|---|
| PubChem CID | 120649189 |
| Molecular Formula | C21H34ClN3O2 |
| Molecular Weight | 395.98 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | N-(3-aminopropyl)-N-benzyl-2-[(2-cyclohexylacetyl)amino]propanamide;hydrochloride |
| SMILES | CC(NC(=O)CC1CCCCC1)C(=O)N(CCCN)Cc1ccccc1.Cl |
| InChI | InChI=1S/C21H33N3O2.ClH/c1-17(23-20(25)15-18-9-4-2-5-10-18)21(26)24(14-8-13-22)16-19-11-6-3-7-12-19;/h3,6-7,11-12,17-18H,2,4-5,8-10,13-16,22H2,1H3,(H,23,25);1H |
| InChIKey | UHLSCTHZRNBXSQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.98 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |