C14H23ClN2O3S — CID 120648412
N-(3-aminopropyl)-N-benzyl-2-methylsulfonylpropanamide;hydrochloride (PubChem CID 120648412) has the molecular formula C14H23ClN2O3S and a molecular weight of 334.87 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-benzyl-2-methylsulfonylpropanamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-N-benzyl-2-methylsulfonylpropanamide;hydrochloride |
|---|---|
| PubChem CID | 120648412 |
| Molecular Formula | C14H23ClN2O3S |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | N-(3-aminopropyl)-N-benzyl-2-methylsulfonylpropanamide;hydrochloride |
| SMILES | CC(C(=O)N(CCCN)Cc1ccccc1)S(C)(=O)=O.Cl |
| InChI | InChI=1S/C14H22N2O3S.ClH/c1-12(20(2,18)19)14(17)16(10-6-9-15)11-13-7-4-3-5-8-13;/h3-5,7-8,12H,6,9-11,15H2,1-2H3;1H |
| InChIKey | BFGPHBFOHGUZJP-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |